C12H16Br2N2O2S — CID 93453140
N-[(1R,2R)-2-aminocyclohexyl]-2,4-dibromobenzenesulfonamide (PubChem CID 93453140) has the molecular formula C12H16Br2N2O2S and a molecular weight of 412.15 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-2,4-dibromobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-2,4-dibromobenzenesulfonamide |
|---|---|
| PubChem CID | 93453140 |
| Molecular Formula | C12H16Br2N2O2S |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 409.93 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-2,4-dibromobenzenesulfonamide |
| SMILES | N[C@@H]1CCCC[C@H]1NS(=O)(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H16Br2N2O2S/c13-8-5-6-12(9(14)7-8)19(17,18)16-11-4-2-1-3-10(11)15/h5-7,10-11,16H,1-4,15H2/t10-,11-/m1/s1 |
| InChIKey | BKTSVXJDOPOGBX-GHMZBOCLSA-N |
| XLogP | 2.76 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |