C11H13Br2NO2S2 — CID 113250007
2,4-dibromo-N-(thian-3-yl)benzenesulfonamide (PubChem CID 113250007) has the molecular formula C11H13Br2NO2S2 and a molecular weight of 415.17 g/mol. Its IUPAC name is 2,4-dibromo-N-(thian-3-yl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(thian-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 113250007 |
| Molecular Formula | C11H13Br2NO2S2 |
| Molecular Weight | 415.17 g/mol |
| Exact Mass | 412.88 |
| IUPAC Name | 2,4-dibromo-N-(thian-3-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCSC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H13Br2NO2S2/c12-8-3-4-11(10(13)6-8)18(15,16)14-9-2-1-5-17-7-9/h3-4,6,9,14H,1-2,5,7H2 |
| InChIKey | OTEAYFDUVNGJML-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |