C10H13BrN2O2S2 — CID 103062283
2-amino-4-bromo-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 103062283) has the molecular formula C10H13BrN2O2S2 and a molecular weight of 337.26 g/mol. Its IUPAC name is 2-amino-4-bromo-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103062283 |
| Molecular Formula | C10H13BrN2O2S2 |
| Molecular Weight | 337.26 g/mol |
| Exact Mass | 335.96 |
| IUPAC Name | 2-amino-4-bromo-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | Nc1cc(Br)ccc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C10H13BrN2O2S2/c11-7-1-2-10(9(12)5-7)17(14,15)13-8-3-4-16-6-8/h1-2,5,8,13H,3-4,6,12H2 |
| InChIKey | MJQYLDYQHCDITL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|