C12H18N2O3S2 — CID 103062286
5-amino-2-methoxy-4-methyl-N-(thiolan-3-yl)benzenesulfonamide (PubChem CID 103062286) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 5-amino-2-methoxy-4-methyl-N-(thiolan-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-methoxy-4-methyl-N-(thiolan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103062286 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 5-amino-2-methoxy-4-methyl-N-(thiolan-3-yl)benzenesulfonamide |
| SMILES | COc1cc(C)c(N)cc1S(=O)(=O)NC1CCSC1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-8-5-11(17-2)12(6-10(8)13)19(15,16)14-9-3-4-18-7-9/h5-6,9,14H,3-4,7,13H2,1-2H3 |
| InChIKey | KGDOQMPRNHNLJC-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|