C14H22N2O4S — CID 107213489
5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxy-4-methylbenzenesulfonamide (PubChem CID 107213489) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxy-4-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxy-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107213489 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 5-amino-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxy-4-methylbenzenesulfonamide |
| SMILES | COc1cc(C)c(N)cc1S(=O)(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H22N2O4S/c1-9-7-13(20-2)14(8-10(9)15)21(18,19)16-11-5-3-4-6-12(11)17/h7-8,11-12,16-17H,3-6,15H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | XZRVSVCRNAOTMS-RYUDHWBXSA-N |
| XLogP | 1.17 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|