C13H19BrN2O4S — CID 107213517
5-amino-4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxybenzenesulfonamide (PubChem CID 107213517) has the molecular formula C13H19BrN2O4S and a molecular weight of 379.28 g/mol. Its IUPAC name is 5-amino-4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 107213517 |
| Molecular Formula | C13H19BrN2O4S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | 5-amino-4-bromo-N-[(1S,2S)-2-hydroxycyclohexyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C13H19BrN2O4S/c1-20-12-6-8(14)9(15)7-13(12)21(18,19)16-10-4-2-3-5-11(10)17/h6-7,10-11,16-17H,2-5,15H2,1H3/t10-,11-/m0/s1 |
| InChIKey | ASAGMALMSBLXTL-QWRGUYRKSA-N |
| XLogP | 1.62 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|