C14H21BrN2O3S — CID 81397159
5-amino-4-bromo-2-methoxy-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide (PubChem CID 81397159) has the molecular formula C14H21BrN2O3S and a molecular weight of 377.30 g/mol. Its IUPAC name is 5-amino-4-bromo-2-methoxy-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-methoxy-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 81397159 |
| Molecular Formula | C14H21BrN2O3S |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 5-amino-4-bromo-2-methoxy-N-(2,2,3,3-tetramethylcyclopropyl)benzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)NC1C(C)(C)C1(C)C |
| InChI | InChI=1S/C14H21BrN2O3S/c1-13(2)12(14(13,3)4)17-21(18,19)11-7-9(16)8(15)6-10(11)20-5/h6-7,12,17H,16H2,1-5H3 |
| InChIKey | ZGIJJAXISRLMLB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|