C11H16BrN3O4S — CID 81413600
2-[(5-amino-4-bromo-2-methoxyphenyl)sulfonylamino]-2-methylpropanamide (PubChem CID 81413600) has the molecular formula C11H16BrN3O4S and a molecular weight of 366.24 g/mol. Its IUPAC name is 2-[(5-amino-4-bromo-2-methoxyphenyl)sulfonylamino]-2-methylpropanamide.
| Compound Name | 2-[(5-amino-4-bromo-2-methoxyphenyl)sulfonylamino]-2-methylpropanamide |
|---|---|
| PubChem CID | 81413600 |
| Molecular Formula | C11H16BrN3O4S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | 2-[(5-amino-4-bromo-2-methoxyphenyl)sulfonylamino]-2-methylpropanamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)NC(C)(C)C(N)=O |
| InChI | InChI=1S/C11H16BrN3O4S/c1-11(2,10(14)16)15-20(17,18)9-5-7(13)6(12)4-8(9)19-3/h4-5,15H,13H2,1-3H3,(H2,14,16) |
| InChIKey | DWYXSXYYBUFACK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|