C11H10Br2N4O3S — CID 81397943
5-amino-4-bromo-N-(5-bromopyrazin-2-yl)-2-methoxybenzenesulfonamide (PubChem CID 81397943) has the molecular formula C11H10Br2N4O3S and a molecular weight of 438.10 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(5-bromopyrazin-2-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(5-bromopyrazin-2-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 81397943 |
| Molecular Formula | C11H10Br2N4O3S |
| Molecular Weight | 438.10 g/mol |
| Exact Mass | 435.88 |
| IUPAC Name | 5-amino-4-bromo-N-(5-bromopyrazin-2-yl)-2-methoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)Nc1cnc(Br)cn1 |
| InChI | InChI=1S/C11H10Br2N4O3S/c1-20-8-2-6(12)7(14)3-9(8)21(18,19)17-11-5-15-10(13)4-16-11/h2-5H,14H2,1H3,(H,16,17) |
| InChIKey | IMZVMGHICAVLEV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.10 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|