C11H12BrN3O3S2 — CID 81413594
5-amino-4-bromo-2-methoxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 81413594) has the molecular formula C11H12BrN3O3S2 and a molecular weight of 378.27 g/mol. Its IUPAC name is 5-amino-4-bromo-2-methoxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-2-methoxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 81413594 |
| Molecular Formula | C11H12BrN3O3S2 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | 5-amino-4-bromo-2-methoxy-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | COc1cc(Br)c(N)cc1S(=O)(=O)Nc1nc(C)cs1 |
| InChI | InChI=1S/C11H12BrN3O3S2/c1-6-5-19-11(14-6)15-20(16,17)10-4-8(13)7(12)3-9(10)18-2/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | GGKYOCNPVYMZAO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|