C11H13BrN4O3S2 — CID 107641445
5-amino-4-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methoxybenzenesulfonamide (PubChem CID 107641445) has the molecular formula C11H13BrN4O3S2 and a molecular weight of 393.29 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 107641445 |
| Molecular Formula | C11H13BrN4O3S2 |
| Molecular Weight | 393.29 g/mol |
| Exact Mass | 391.96 |
| IUPAC Name | 5-amino-4-bromo-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-methoxybenzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2cc(N)c(Br)cc2OC)s1 |
| InChI | InChI=1S/C11H13BrN4O3S2/c1-3-10-14-15-11(20-10)16-21(17,18)9-5-7(13)6(12)4-8(9)19-2/h4-5H,3,13H2,1-2H3,(H,15,16) |
| InChIKey | VASPTQCQAARIKE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|