C12H16N4O2S2 — CID 107641384
2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4,5-dimethylbenzenesulfonamide (PubChem CID 107641384) has the molecular formula C12H16N4O2S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4,5-dimethylbenzenesulfonamide.
| Compound Name | 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107641384 |
| Molecular Formula | C12H16N4O2S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 2-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)-4,5-dimethylbenzenesulfonamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2cc(C)c(C)cc2N)s1 |
| InChI | InChI=1S/C12H16N4O2S2/c1-4-11-14-15-12(19-11)16-20(17,18)10-6-8(3)7(2)5-9(10)13/h5-6H,4,13H2,1-3H3,(H,15,16) |
| InChIKey | VFDHYHZWXSLLGQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|