C10H13N4NaO2S2 — CID 3083738
sodium;4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide;hydride (PubChem CID 3083738) has the molecular formula C10H13N4NaO2S2 and a molecular weight of 308.36 g/mol. Its IUPAC name is sodium;4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide;hydride.
| Compound Name | sodium;4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide;hydride |
|---|---|
| PubChem CID | 3083738 |
| Molecular Formula | C10H13N4NaO2S2 |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | sodium;4-amino-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide;hydride |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(N)cc2)s1.[H-].[Na+] |
| InChI | InChI=1S/C10H12N4O2S2.Na.H/c1-2-9-12-13-10(17-9)14-18(15,16)8-5-3-7(11)4-6-8;;/h3-6H,2,11H2,1H3,(H,13,14);;/q;+1;-1 |
| InChIKey | ZTHPKFOZCKKHDE-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|