C12H15N3O2S2 — CID 25041652
4-ethyl-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 25041652) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.41 g/mol. Its IUPAC name is 4-ethyl-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-ethyl-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 25041652 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-ethyl-N-(5-ethyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2nnc(CC)s2)cc1 |
| InChI | InChI=1S/C12H15N3O2S2/c1-3-9-5-7-10(8-6-9)19(16,17)15-12-14-13-11(4-2)18-12/h5-8H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | DJUCDCYGNMRKPV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |