C10H11N5O2S3 — CID 107642048
5-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]pyridine-2-carbothioamide (PubChem CID 107642048) has the molecular formula C10H11N5O2S3 and a molecular weight of 329.43 g/mol. Its IUPAC name is 5-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 5-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 107642048 |
| Molecular Formula | C10H11N5O2S3 |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 5-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]pyridine-2-carbothioamide |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(C(N)=S)nc2)s1 |
| InChI | InChI=1S/C10H11N5O2S3/c1-2-8-13-14-10(19-8)15-20(16,17)6-3-4-7(9(11)18)12-5-6/h3-5H,2H2,1H3,(H2,11,18)(H,14,15) |
| InChIKey | APDCXNNJPVSEOZ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|