C12H19N3O2S2 — CID 103461809
5-(2,2-dimethylbutylsulfamoyl)pyridine-2-carbothioamide (PubChem CID 103461809) has the molecular formula C12H19N3O2S2 and a molecular weight of 301.44 g/mol. Its IUPAC name is 5-(2,2-dimethylbutylsulfamoyl)pyridine-2-carbothioamide.
| Compound Name | 5-(2,2-dimethylbutylsulfamoyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 103461809 |
| Molecular Formula | C12H19N3O2S2 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-(2,2-dimethylbutylsulfamoyl)pyridine-2-carbothioamide |
| SMILES | CCC(C)(C)CNS(=O)(=O)c1ccc(C(N)=S)nc1 |
| InChI | InChI=1S/C12H19N3O2S2/c1-4-12(2,3)8-15-19(16,17)9-5-6-10(11(13)18)14-7-9/h5-7,15H,4,8H2,1-3H3,(H2,13,18) |
| InChIKey | DRALQOVBDMZAGN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|