C12H15BrN4O3S — CID 81396831
5-amino-4-bromo-N-(1-ethylpyrazol-4-yl)-2-methoxybenzenesulfonamide (PubChem CID 81396831) has the molecular formula C12H15BrN4O3S and a molecular weight of 375.25 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(1-ethylpyrazol-4-yl)-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(1-ethylpyrazol-4-yl)-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 81396831 |
| Molecular Formula | C12H15BrN4O3S |
| Molecular Weight | 375.25 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 5-amino-4-bromo-N-(1-ethylpyrazol-4-yl)-2-methoxybenzenesulfonamide |
| SMILES | CCn1cc(NS(=O)(=O)c2cc(N)c(Br)cc2OC)cn1 |
| InChI | InChI=1S/C12H15BrN4O3S/c1-3-17-7-8(6-15-17)16-21(18,19)12-5-10(14)9(13)4-11(12)20-2/h4-7,16H,3,14H2,1-2H3 |
| InChIKey | JOZPDIOXUIESMW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|