C10H9Br2N3O2S2 — CID 43257975
2-amino-4,6-dibromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 43257975) has the molecular formula C10H9Br2N3O2S2 and a molecular weight of 427.14 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43257975 |
| Molecular Formula | C10H9Br2N3O2S2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.85 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(4-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1csc(NS(=O)(=O)c2c(N)cc(Br)cc2Br)n1 |
| InChI | InChI=1S/C10H9Br2N3O2S2/c1-5-4-18-10(14-5)15-19(16,17)9-7(12)2-6(11)3-8(9)13/h2-4H,13H2,1H3,(H,14,15) |
| InChIKey | KJBSNVGCORWNLS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|