C11H11N3O4S2 — CID 81471188
3-amino-4-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 81471188) has the molecular formula C11H11N3O4S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-amino-4-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-amino-4-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 81471188 |
| Molecular Formula | C11H11N3O4S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 3-amino-4-[(4-methyl-1,3-thiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1csc(NS(=O)(=O)c2ccc(C(=O)O)cc2N)n1 |
| InChI | InChI=1S/C11H11N3O4S2/c1-6-5-19-11(13-6)14-20(17,18)9-3-2-7(10(15)16)4-8(9)12/h2-5H,12H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | DJYYYDPLEAGWMM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|