C11H12N4O4S — CID 81470825
3-amino-4-[(2-methylpyrazol-3-yl)sulfamoyl]benzoic acid (PubChem CID 81470825) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 3-amino-4-[(2-methylpyrazol-3-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-amino-4-[(2-methylpyrazol-3-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 81470825 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 3-amino-4-[(2-methylpyrazol-3-yl)sulfamoyl]benzoic acid |
| SMILES | Cn1nccc1NS(=O)(=O)c1ccc(C(=O)O)cc1N |
| InChI | InChI=1S/C11H12N4O4S/c1-15-10(4-5-13-15)14-20(18,19)9-3-2-7(11(16)17)6-8(9)12/h2-6,14H,12H2,1H3,(H,16,17) |
| InChIKey | AKXXOPIVNDZSOS-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|