C11H9ClN4O4S — CID 116794764
3-amino-4-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid (PubChem CID 116794764) has the molecular formula C11H9ClN4O4S and a molecular weight of 328.74 g/mol. Its IUPAC name is 3-amino-4-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid.
| Compound Name | 3-amino-4-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 116794764 |
| Molecular Formula | C11H9ClN4O4S |
| Molecular Weight | 328.74 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 3-amino-4-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid |
| SMILES | Nc1cc(C(=O)O)ccc1S(=O)(=O)Nc1ccnc(Cl)n1 |
| InChI | InChI=1S/C11H9ClN4O4S/c12-11-14-4-3-9(15-11)16-21(19,20)8-2-1-6(10(17)18)5-7(8)13/h1-5H,13H2,(H,17,18)(H,14,15,16) |
| InChIKey | PHJDPSPVBAKAGP-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.74 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|