C11H7BrClN3O4S — CID 116794818
4-bromo-3-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid (PubChem CID 116794818) has the molecular formula C11H7BrClN3O4S and a molecular weight of 392.62 g/mol. Its IUPAC name is 4-bromo-3-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid.
| Compound Name | 4-bromo-3-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 116794818 |
| Molecular Formula | C11H7BrClN3O4S |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 390.90 |
| IUPAC Name | 4-bromo-3-[(2-chloropyrimidin-4-yl)sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Br)c(S(=O)(=O)Nc2ccnc(Cl)n2)c1 |
| InChI | InChI=1S/C11H7BrClN3O4S/c12-7-2-1-6(10(17)18)5-8(7)21(19,20)16-9-3-4-14-11(13)15-9/h1-5H,(H,17,18)(H,14,15,16) |
| InChIKey | JYWWJJBHHZFPHZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |