C8H4Br2ClN3O2S2 — CID 116798850
2,5-dibromo-N-(2-chloropyrimidin-4-yl)thiophene-3-sulfonamide (PubChem CID 116798850) has the molecular formula C8H4Br2ClN3O2S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-chloropyrimidin-4-yl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-(2-chloropyrimidin-4-yl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 116798850 |
| Molecular Formula | C8H4Br2ClN3O2S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 430.78 |
| IUPAC Name | 2,5-dibromo-N-(2-chloropyrimidin-4-yl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccnc(Cl)n1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H4Br2ClN3O2S2/c9-5-3-4(7(10)17-5)18(15,16)14-6-1-2-12-8(11)13-6/h1-3H,(H,12,13,14) |
| InChIKey | OIASSXYITXGGSG-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |