C9H5Br2ClN2O2S2 — CID 103601783
2,5-dibromo-N-(2-chloro-3-pyridinyl)thiophene-3-sulfonamide (PubChem CID 103601783) has the molecular formula C9H5Br2ClN2O2S2 and a molecular weight of 432.55 g/mol. Its IUPAC name is 2,5-dibromo-N-(2-chloro-3-pyridinyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-(2-chloro-3-pyridinyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 103601783 |
| Molecular Formula | C9H5Br2ClN2O2S2 |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 429.78 |
| IUPAC Name | 2,5-dibromo-N-(2-chloro-3-pyridinyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cccnc1Cl)c1cc(Br)sc1Br |
| InChI | InChI=1S/C9H5Br2ClN2O2S2/c10-7-4-6(8(11)17-7)18(15,16)14-5-2-1-3-13-9(5)12/h1-4,14H |
| InChIKey | ZIUYYENXEYXUMO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|