C11H9Br2NO3S2 — CID 60651453
2,5-dibromo-N-[2-(hydroxymethyl)phenyl]thiophene-3-sulfonamide (PubChem CID 60651453) has the molecular formula C11H9Br2NO3S2 and a molecular weight of 427.14 g/mol. Its IUPAC name is 2,5-dibromo-N-[2-(hydroxymethyl)phenyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-[2-(hydroxymethyl)phenyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 60651453 |
| Molecular Formula | C11H9Br2NO3S2 |
| Molecular Weight | 427.14 g/mol |
| Exact Mass | 424.84 |
| IUPAC Name | 2,5-dibromo-N-[2-(hydroxymethyl)phenyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1CO)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H9Br2NO3S2/c12-10-5-9(11(13)18-10)19(16,17)14-8-4-2-1-3-7(8)6-15/h1-5,14-15H,6H2 |
| InChIKey | OJAHFLQHNFKWDG-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |