C8H11Br2NO3S2 — CID 106843930
2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-sulfonamide (PubChem CID 106843930) has the molecular formula C8H11Br2NO3S2 and a molecular weight of 393.12 g/mol. Its IUPAC name is 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106843930 |
| Molecular Formula | C8H11Br2NO3S2 |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.85 |
| IUPAC Name | 2,5-dibromo-N-(4-hydroxybutyl)thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCCCO)c1cc(Br)sc1Br |
| InChI | InChI=1S/C8H11Br2NO3S2/c9-7-5-6(8(10)15-7)16(13,14)11-3-1-2-4-12/h5,11-12H,1-4H2 |
| InChIKey | GFPXXOAMCDCASS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|