C10H14Br2N2O2S2 — CID 43598645
2,5-dibromo-N-[3-(cyclopropylamino)propyl]thiophene-3-sulfonamide (PubChem CID 43598645) has the molecular formula C10H14Br2N2O2S2 and a molecular weight of 418.18 g/mol. Its IUPAC name is 2,5-dibromo-N-[3-(cyclopropylamino)propyl]thiophene-3-sulfonamide.
| Compound Name | 2,5-dibromo-N-[3-(cyclopropylamino)propyl]thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 43598645 |
| Molecular Formula | C10H14Br2N2O2S2 |
| Molecular Weight | 418.18 g/mol |
| Exact Mass | 415.89 |
| IUPAC Name | 2,5-dibromo-N-[3-(cyclopropylamino)propyl]thiophene-3-sulfonamide |
| SMILES | O=S(=O)(NCCCNC1CC1)c1cc(Br)sc1Br |
| InChI | InChI=1S/C10H14Br2N2O2S2/c11-9-6-8(10(12)17-9)18(15,16)14-5-1-4-13-7-2-3-7/h6-7,13-14H,1-5H2 |
| InChIKey | SEQHQGHOKJXVHP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.18 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|