C11H15Br2NO4S2 — CID 43405597
methyl 6-[(2,5-dibromothiophen-3-yl)sulfonylamino]hexanoate (PubChem CID 43405597) has the molecular formula C11H15Br2NO4S2 and a molecular weight of 449.19 g/mol. Its IUPAC name is methyl 6-[(2,5-dibromothiophen-3-yl)sulfonylamino]hexanoate.
| Compound Name | methyl 6-[(2,5-dibromothiophen-3-yl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 43405597 |
| Molecular Formula | C11H15Br2NO4S2 |
| Molecular Weight | 449.19 g/mol |
| Exact Mass | 446.88 |
| IUPAC Name | methyl 6-[(2,5-dibromothiophen-3-yl)sulfonylamino]hexanoate |
| SMILES | COC(=O)CCCCCNS(=O)(=O)c1cc(Br)sc1Br |
| InChI | InChI=1S/C11H15Br2NO4S2/c1-18-10(15)5-3-2-4-6-14-20(16,17)8-7-9(12)19-11(8)13/h7,14H,2-6H2,1H3 |
| InChIKey | JXEHKKIYMMGXHZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|