C14H20BrNO4S — CID 43423584
methyl 6-[(2-bromo-4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 43423584) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is methyl 6-[(2-bromo-4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | methyl 6-[(2-bromo-4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 43423584 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | methyl 6-[(2-bromo-4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | COC(=O)CCCCCNS(=O)(=O)c1ccc(C)cc1Br |
| InChI | InChI=1S/C14H20BrNO4S/c1-11-7-8-13(12(15)10-11)21(18,19)16-9-5-3-4-6-14(17)20-2/h7-8,10,16H,3-6,9H2,1-2H3 |
| InChIKey | AZMVJWJTGQZDBS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|