C12H15BrF3NO2S — CID 115486665
2-bromo-4-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115486665) has the molecular formula C12H15BrF3NO2S and a molecular weight of 374.22 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115486665 |
| Molecular Formula | C12H15BrF3NO2S |
| Molecular Weight | 374.22 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 2-bromo-4-methyl-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H15BrF3NO2S/c1-9-4-5-11(10(13)8-9)20(18,19)17-7-3-2-6-12(14,15)16/h4-5,8,17H,2-3,6-7H2,1H3 |
| InChIKey | MANZDPAMMYMFJM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.22 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|