C9H9BrF3NO2S — CID 60824533
2-bromo-4-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60824533) has the molecular formula C9H9BrF3NO2S and a molecular weight of 332.14 g/mol. Its IUPAC name is 2-bromo-4-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60824533 |
| Molecular Formula | C9H9BrF3NO2S |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 330.95 |
| IUPAC Name | 2-bromo-4-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C9H9BrF3NO2S/c1-6-2-3-8(7(10)4-6)17(15,16)14-5-9(11,12)13/h2-4,14H,5H2,1H3 |
| InChIKey | KBOMHQYCYJEJMA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |