C12H15BrF3NO3S — CID 115522718
2-bromo-4-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115522718) has the molecular formula C12H15BrF3NO3S and a molecular weight of 390.22 g/mol. Its IUPAC name is 2-bromo-4-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 2-bromo-4-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115522718 |
| Molecular Formula | C12H15BrF3NO3S |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 2-bromo-4-(hydroxymethyl)-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCCC(F)(F)F)c1ccc(CO)cc1Br |
| InChI | InChI=1S/C12H15BrF3NO3S/c13-10-7-9(8-18)3-4-11(10)21(19,20)17-6-2-1-5-12(14,15)16/h3-4,7,17-18H,1-2,5-6,8H2 |
| InChIKey | XKHDJNKZODUIOB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|