C12H14F3N3O2S — CID 115515150
2-amino-4-cyano-N-(5,5,5-trifluoropentyl)benzenesulfonamide (PubChem CID 115515150) has the molecular formula C12H14F3N3O2S and a molecular weight of 321.32 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(5,5,5-trifluoropentyl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115515150 |
| Molecular Formula | C12H14F3N3O2S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-amino-4-cyano-N-(5,5,5-trifluoropentyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCCCC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C12H14F3N3O2S/c13-12(14,15)5-1-2-6-18-21(19,20)11-4-3-9(8-16)7-10(11)17/h3-4,7,18H,1-2,5-6,17H2 |
| InChIKey | RXBHABXFBLYPMS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|