C12H17N3O3S — CID 115357947
2-amino-4-cyano-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide (PubChem CID 115357947) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-amino-4-cyano-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide.
| Compound Name | 2-amino-4-cyano-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 115357947 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-amino-4-cyano-N-(3-hydroxy-2,2-dimethylpropyl)benzenesulfonamide |
| SMILES | CC(C)(CO)CNS(=O)(=O)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C12H17N3O3S/c1-12(2,8-16)7-15-19(17,18)11-4-3-9(6-13)5-10(11)14/h3-5,15-16H,7-8,14H2,1-2H3 |
| InChIKey | CUNAZJCAXFAYRC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|