C13H18N4O3S — CID 106274931
3-[(2-amino-4-cyanophenyl)sulfonylamino]-N,2,2-trimethylpropanamide (PubChem CID 106274931) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 3-[(2-amino-4-cyanophenyl)sulfonylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2-amino-4-cyanophenyl)sulfonylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106274931 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-[(2-amino-4-cyanophenyl)sulfonylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNS(=O)(=O)c1ccc(C#N)cc1N |
| InChI | InChI=1S/C13H18N4O3S/c1-13(2,12(18)16-3)8-17-21(19,20)11-5-4-9(7-14)6-10(11)15/h4-6,17H,8,15H2,1-3H3,(H,16,18) |
| InChIKey | GGGDSLCHYQQGQK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 125.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|