C13H21N3O3S — CID 106275000
3-[(3-amino-4-methylphenyl)sulfonylamino]-N,2,2-trimethylpropanamide (PubChem CID 106275000) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 3-[(3-amino-4-methylphenyl)sulfonylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(3-amino-4-methylphenyl)sulfonylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275000 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 3-[(3-amino-4-methylphenyl)sulfonylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNS(=O)(=O)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-9-5-6-10(7-11(9)14)20(18,19)16-8-13(2,3)12(17)15-4/h5-7,16H,8,14H2,1-4H3,(H,15,17) |
| InChIKey | KLIAHWBBPUVWDG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|