C13H19BrN2O3S — CID 106279745
3-[[4-(bromomethyl)phenyl]sulfonylamino]-N,2,2-trimethylpropanamide (PubChem CID 106279745) has the molecular formula C13H19BrN2O3S and a molecular weight of 363.28 g/mol. Its IUPAC name is 3-[[4-(bromomethyl)phenyl]sulfonylamino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[[4-(bromomethyl)phenyl]sulfonylamino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106279745 |
| Molecular Formula | C13H19BrN2O3S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | 3-[[4-(bromomethyl)phenyl]sulfonylamino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNS(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C13H19BrN2O3S/c1-13(2,12(17)15-3)9-16-20(18,19)11-6-4-10(8-14)5-7-11/h4-7,16H,8-9H2,1-3H3,(H,15,17) |
| InChIKey | DNKJQXMSPMCZEJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|