C12H19N3O3S — CID 106279964
2,2-dimethyl-3-[[4-(methylamino)phenyl]sulfonylamino]propanamide (PubChem CID 106279964) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[4-(methylamino)phenyl]sulfonylamino]propanamide.
| Compound Name | 2,2-dimethyl-3-[[4-(methylamino)phenyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 106279964 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 2,2-dimethyl-3-[[4-(methylamino)phenyl]sulfonylamino]propanamide |
| SMILES | CNc1ccc(S(=O)(=O)NCC(C)(C)C(N)=O)cc1 |
| InChI | InChI=1S/C12H19N3O3S/c1-12(2,11(13)16)8-15-19(17,18)10-6-4-9(14-3)5-7-10/h4-7,14-15H,8H2,1-3H3,(H2,13,16) |
| InChIKey | YNKFRGTTZAUQHV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |