C13H18N2O5S — CID 106275642
3-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 106275642) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 106275642 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C13H18N2O5S/c1-8-4-5-9(11(16)17)6-10(8)21(19,20)15-7-13(2,3)12(14)18/h4-6,15H,7H2,1-3H3,(H2,14,18)(H,16,17) |
| InChIKey | ZBYAOJSTVOQOLD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |