4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid

C10H10F3NO4S — CID 29043972

IUPAC4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid
SMILESCc1ccc(C(=O)O)cc1S(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C10H10F3NO4S/c1-6-2-3-7(9(15)16)4-8(6)19(17,18)14-5-10(11,12)13/h2-4,14H,5H2,1H3,(H,15,16)
InChIKeyWVOWUCLLUVJWGP-UHFFFAOYSA-N
MW297.25 g/mol
LogP1.53
Rot. Bonds4

About 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid

4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid (PubChem CID 29043972) has the molecular formula C10H10F3NO4S and a molecular weight of 297.25 g/mol. Its IUPAC name is 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid.

Molecular Properties

Compound Name4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid
PubChem CID29043972
Molecular FormulaC10H10F3NO4S
Molecular Weight297.25 g/mol
Exact Mass297.03
IUPAC Name4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid
SMILESCc1ccc(C(=O)O)cc1S(=O)(=O)NCC(F)(F)F
InChIInChI=1S/C10H10F3NO4S/c1-6-2-3-7(9(15)16)4-8(6)19(17,18)14-5-10(11,12)13/h2-4,14H,5H2,1H3,(H,15,16)
InChIKeyWVOWUCLLUVJWGP-UHFFFAOYSA-N
XLogP1.53
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500297.25
LogP ≤ 51.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The IUPAC name of 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid (CID 29043972) is 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid.
What is the SMILES notation for 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The canonical SMILES for 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid is Cc1ccc(C(=O)O)cc1S(=O)(=O)NCC(F)(F)F.
What is the InChIKey of 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
The InChIKey is WVOWUCLLUVJWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO4S/c1-6-2-3-7(9(15)16)4-8(6)19(17,18)14-5-10(11,12)13/h2-4,14H,5H2,1H3,(H,15,16).
What are the key properties of 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid?
4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid has a molecular weight of 297.25 g/mol, XLogP of 1.53, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-(2,2,2-trifluoroethylsulfamoyl)benzoic acid is sourced from PubChem (CID 29043972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).