C13H19NO5S2 — CID 106244678
3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]-4-methylbenzoic acid (PubChem CID 106244678) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 106244678 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 3-[(2-hydroxy-2-methyl-3-methylsulfanylpropyl)sulfamoyl]-4-methylbenzoic acid |
| SMILES | CSCC(C)(O)CNS(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C13H19NO5S2/c1-9-4-5-10(12(15)16)6-11(9)21(18,19)14-7-13(2,17)8-20-3/h4-6,14,17H,7-8H2,1-3H3,(H,15,16) |
| InChIKey | YXEJABGLNOXLTH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |