C14H15NO4S2 — CID 112726216
4-methyl-3-[(3-methylthiophen-2-yl)methylsulfamoyl]benzoic acid (PubChem CID 112726216) has the molecular formula C14H15NO4S2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-methyl-3-[(3-methylthiophen-2-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 4-methyl-3-[(3-methylthiophen-2-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 112726216 |
| Molecular Formula | C14H15NO4S2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 4-methyl-3-[(3-methylthiophen-2-yl)methylsulfamoyl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NCc1sccc1C |
| InChI | InChI=1S/C14H15NO4S2/c1-9-5-6-20-12(9)8-15-21(18,19)13-7-11(14(16)17)4-3-10(13)2/h3-7,15H,8H2,1-2H3,(H,16,17) |
| InChIKey | PYNMNOGNVDTGEC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |