C12H13NO2S2 — CID 2811533
N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide (PubChem CID 2811533) has the molecular formula C12H13NO2S2 and a molecular weight of 267.38 g/mol. Its IUPAC name is N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide.
| Compound Name | N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 2811533 |
| Molecular Formula | C12H13NO2S2 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | N-[(3-methylthiophen-2-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ccsc1CNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H13NO2S2/c1-10-7-8-16-12(10)9-13-17(14,15)11-5-3-2-4-6-11/h2-8,13H,9H2,1H3 |
| InChIKey | SHWJTMQZRWGXSG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |