C12H12BrNO2S2 — CID 79471456
N-[(3-bromothiophen-2-yl)methyl]-2-methylbenzenesulfonamide (PubChem CID 79471456) has the molecular formula C12H12BrNO2S2 and a molecular weight of 346.27 g/mol. Its IUPAC name is N-[(3-bromothiophen-2-yl)methyl]-2-methylbenzenesulfonamide.
| Compound Name | N-[(3-bromothiophen-2-yl)methyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79471456 |
| Molecular Formula | C12H12BrNO2S2 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | N-[(3-bromothiophen-2-yl)methyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1ccccc1S(=O)(=O)NCc1sccc1Br |
| InChI | InChI=1S/C12H12BrNO2S2/c1-9-4-2-3-5-12(9)18(15,16)14-8-11-10(13)6-7-17-11/h2-7,14H,8H2,1H3 |
| InChIKey | GLGULALHDYWECU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |