C12H17NO5S2 — CID 104656134
4-methyl-3-(2-methylsulfinylpropylsulfamoyl)benzoic acid (PubChem CID 104656134) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-methyl-3-(2-methylsulfinylpropylsulfamoyl)benzoic acid.
| Compound Name | 4-methyl-3-(2-methylsulfinylpropylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 104656134 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 4-methyl-3-(2-methylsulfinylpropylsulfamoyl)benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1S(=O)(=O)NCC(C)S(C)=O |
| InChI | InChI=1S/C12H17NO5S2/c1-8-4-5-10(12(14)15)6-11(8)20(17,18)13-7-9(2)19(3)16/h4-6,9,13H,7H2,1-3H3,(H,14,15) |
| InChIKey | HANATSZVVVBMAN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |