C12H17N3O5S — CID 106274852
5-amino-2-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]benzoic acid (PubChem CID 106274852) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 5-amino-2-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]benzoic acid.
| Compound Name | 5-amino-2-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 106274852 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 5-amino-2-[(3-amino-2,2-dimethyl-3-oxopropyl)sulfamoyl]benzoic acid |
| SMILES | CC(C)(CNS(=O)(=O)c1ccc(N)cc1C(=O)O)C(N)=O |
| InChI | InChI=1S/C12H17N3O5S/c1-12(2,11(14)18)6-15-21(19,20)9-4-3-7(13)5-8(9)10(16)17/h3-5,15H,6,13H2,1-2H3,(H2,14,18)(H,16,17) |
| InChIKey | ZUALVYHYEJFWSG-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 152.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|