C12H18FN3O3S — CID 106274893
3-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide (PubChem CID 106274893) has the molecular formula C12H18FN3O3S and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 106274893 |
| Molecular Formula | C12H18FN3O3S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]-2,2-dimethylpropanamide |
| SMILES | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(C)(C)C(N)=O |
| InChI | InChI=1S/C12H18FN3O3S/c1-7-9(13)4-8(14)5-10(7)20(18,19)16-6-12(2,3)11(15)17/h4-5,16H,6,14H2,1-3H3,(H2,15,17) |
| InChIKey | MADJYKWBGFYJTC-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|