C10H14FN3O4S — CID 83202378
2-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]ethyl carbamate (PubChem CID 83202378) has the molecular formula C10H14FN3O4S and a molecular weight of 291.30 g/mol. Its IUPAC name is 2-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]ethyl carbamate.
| Compound Name | 2-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83202378 |
| Molecular Formula | C10H14FN3O4S |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(5-amino-3-fluoro-2-methylphenyl)sulfonylamino]ethyl carbamate |
| SMILES | Cc1c(F)cc(N)cc1S(=O)(=O)NCCOC(N)=O |
| InChI | InChI=1S/C10H14FN3O4S/c1-6-8(11)4-7(12)5-9(6)19(16,17)14-2-3-18-10(13)15/h4-5,14H,2-3,12H2,1H3,(H2,13,15) |
| InChIKey | UXICKDFRPSBZMF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|