C12H20FN3O2S — CID 79896277
5-amino-N-[3-(dimethylamino)propyl]-3-fluoro-2-methylbenzenesulfonamide (PubChem CID 79896277) has the molecular formula C12H20FN3O2S and a molecular weight of 289.38 g/mol. Its IUPAC name is 5-amino-N-[3-(dimethylamino)propyl]-3-fluoro-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-N-[3-(dimethylamino)propyl]-3-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 79896277 |
| Molecular Formula | C12H20FN3O2S |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 5-amino-N-[3-(dimethylamino)propyl]-3-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1c(F)cc(N)cc1S(=O)(=O)NCCCN(C)C |
| InChI | InChI=1S/C12H20FN3O2S/c1-9-11(13)7-10(14)8-12(9)19(17,18)15-5-4-6-16(2)3/h7-8,15H,4-6,14H2,1-3H3 |
| InChIKey | MKUYVRIQEDELLB-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|