C13H21FN2O3S — CID 106139792
5-amino-3-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2-methylbenzenesulfonamide (PubChem CID 106139792) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-amino-3-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-3-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106139792 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-amino-3-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2-methylbenzenesulfonamide |
| SMILES | Cc1c(F)cc(N)cc1S(=O)(=O)NCC(C)(C)CCO |
| InChI | InChI=1S/C13H21FN2O3S/c1-9-11(14)6-10(15)7-12(9)20(18,19)16-8-13(2,3)4-5-17/h6-7,16-17H,4-5,8,15H2,1-3H3 |
| InChIKey | KZHJRCICNWBJSG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|